C24H34BNO7S — CID 90064800
N-[2-[3-[(4-methoxyphenyl)methoxy]propoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide (PubChem CID 90064800) has the molecular formula C24H34BNO7S and a molecular weight of 491.42 g/mol. Its IUPAC name is N-[2-[3-[(4-methoxyphenyl)methoxy]propoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide.
| Compound Name | N-[2-[3-[(4-methoxyphenyl)methoxy]propoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 90064800 |
| Molecular Formula | C24H34BNO7S |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | N-[2-[3-[(4-methoxyphenyl)methoxy]propoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
| SMILES | COc1ccc(COCCCOc2ccc(B3OC(C)(C)C(C)(C)O3)cc2NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C24H34BNO7S/c1-23(2)24(3,4)33-25(32-23)19-10-13-22(21(16-19)26-34(6,27)28)31-15-7-14-30-17-18-8-11-20(29-5)12-9-18/h8-13,16,26H,7,14-15,17H2,1-6H3 |
| InChIKey | FOWOIMKGARKRIS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|