C23H28BClO5 — CID 87421696
5-chloro-3-(3-phenylmethoxypropoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (PubChem CID 87421696) has the molecular formula C23H28BClO5 and a molecular weight of 430.74 g/mol. Its IUPAC name is 5-chloro-3-(3-phenylmethoxypropoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde.
| Compound Name | 5-chloro-3-(3-phenylmethoxypropoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 87421696 |
| Molecular Formula | C23H28BClO5 |
| Molecular Weight | 430.74 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 5-chloro-3-(3-phenylmethoxypropoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| SMILES | CC1(C)OB(c2c(C=O)cc(Cl)cc2OCCCOCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C23H28BClO5/c1-22(2)23(3,4)30-24(29-22)21-18(15-26)13-19(25)14-20(21)28-12-8-11-27-16-17-9-6-5-7-10-17/h5-7,9-10,13-15H,8,11-12,16H2,1-4H3 |
| InChIKey | KTCWMLQULADXKQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.74 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|