C24H31BO4 — CID 89054038
2-[2-ethenyl-6-(3-phenylmethoxypropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 89054038) has the molecular formula C24H31BO4 and a molecular weight of 394.32 g/mol. Its IUPAC name is 2-[2-ethenyl-6-(3-phenylmethoxypropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-ethenyl-6-(3-phenylmethoxypropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 89054038 |
| Molecular Formula | C24H31BO4 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-[2-ethenyl-6-(3-phenylmethoxypropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=Cc1cccc(OCCCOCc2ccccc2)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H31BO4/c1-6-20-14-10-15-21(22(20)25-28-23(2,3)24(4,5)29-25)27-17-11-16-26-18-19-12-8-7-9-13-19/h6-10,12-15H,1,11,16-18H2,2-5H3 |
| InChIKey | KPSPTAKXISUFES-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|