C21H33BO6 — CID 87112819
3-(3-butoxypropoxy)-4-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (PubChem CID 87112819) has the molecular formula C21H33BO6 and a molecular weight of 392.30 g/mol. Its IUPAC name is 3-(3-butoxypropoxy)-4-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde.
| Compound Name | 3-(3-butoxypropoxy)-4-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 87112819 |
| Molecular Formula | C21H33BO6 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 3-(3-butoxypropoxy)-4-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| SMILES | CCCCOCCCOc1c(OC)ccc(C=O)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H33BO6/c1-7-8-12-25-13-9-14-26-19-17(24-6)11-10-16(15-23)18(19)22-27-20(2,3)21(4,5)28-22/h10-11,15H,7-9,12-14H2,1-6H3 |
| InChIKey | RIICPXUFHZVBNC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|