C15H18BNO4S — CID 75487338
3-amino-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-2-carboxylic acid (PubChem CID 75487338) has the molecular formula C15H18BNO4S and a molecular weight of 319.19 g/mol. Its IUPAC name is 3-amino-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-amino-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 75487338 |
| Molecular Formula | C15H18BNO4S |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 3-amino-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-2-carboxylic acid |
| SMILES | CC1(C)OB(c2ccc3c(N)c(C(=O)O)sc3c2)OC1(C)C |
| InChI | InChI=1S/C15H18BNO4S/c1-14(2)15(3,4)21-16(20-14)8-5-6-9-10(7-8)22-12(11(9)17)13(18)19/h5-7H,17H2,1-4H3,(H,18,19) |
| InChIKey | NYPBFJDVJPVEGN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|