C25H23BO3S — CID 144622595
2-phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thioxanthen-9-one (PubChem CID 144622595) has the molecular formula C25H23BO3S and a molecular weight of 414.34 g/mol. Its IUPAC name is 2-phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thioxanthen-9-one.
| Compound Name | 2-phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thioxanthen-9-one |
|---|---|
| PubChem CID | 144622595 |
| Molecular Formula | C25H23BO3S |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thioxanthen-9-one |
| SMILES | CC1(C)OB(c2ccc3sc4ccc(-c5ccccc5)cc4c(=O)c3c2)OC1(C)C |
| InChI | InChI=1S/C25H23BO3S/c1-24(2)25(3,4)29-26(28-24)18-11-13-22-20(15-18)23(27)19-14-17(10-12-21(19)30-22)16-8-6-5-7-9-16/h5-15H,1-4H3 |
| InChIKey | CUYAUSJUVBDVDH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|