C10H9NO3S — CID 57099213
3-amino-6-methoxy-1-benzothiophene-2-carboxylic acid (PubChem CID 57099213) has the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. Its IUPAC name is 3-amino-6-methoxy-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-amino-6-methoxy-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 57099213 |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 3-amino-6-methoxy-1-benzothiophene-2-carboxylic acid |
| SMILES | COc1ccc2c(N)c(C(=O)O)sc2c1 |
| InChI | InChI=1S/C10H9NO3S/c1-14-5-2-3-6-7(4-5)15-9(8(6)11)10(12)13/h2-4H,11H2,1H3,(H,12,13) |
| InChIKey | YPHKWWNRVRFHNO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |