C14H12N4O2S — CID 81300692
3-amino-N,N-bis(cyanomethyl)-6-methoxy-1-benzothiophene-2-carboxamide (PubChem CID 81300692) has the molecular formula C14H12N4O2S and a molecular weight of 300.34 g/mol. Its IUPAC name is 3-amino-N,N-bis(cyanomethyl)-6-methoxy-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-N,N-bis(cyanomethyl)-6-methoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 81300692 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 3-amino-N,N-bis(cyanomethyl)-6-methoxy-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2c(N)c(C(=O)N(CC#N)CC#N)sc2c1 |
| InChI | InChI=1S/C14H12N4O2S/c1-20-9-2-3-10-11(8-9)21-13(12(10)17)14(19)18(6-4-15)7-5-16/h2-3,8H,6-7,17H2,1H3 |
| InChIKey | KHFMETAUSJWZQK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|