C13H9BrN4OS — CID 114896343
3-amino-5-bromo-N,N-bis(cyanomethyl)-1-benzothiophene-2-carboxamide (PubChem CID 114896343) has the molecular formula C13H9BrN4OS and a molecular weight of 349.21 g/mol. Its IUPAC name is 3-amino-5-bromo-N,N-bis(cyanomethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-5-bromo-N,N-bis(cyanomethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114896343 |
| Molecular Formula | C13H9BrN4OS |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 3-amino-5-bromo-N,N-bis(cyanomethyl)-1-benzothiophene-2-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)c1sc2ccc(Br)cc2c1N |
| InChI | InChI=1S/C13H9BrN4OS/c14-8-1-2-10-9(7-8)11(17)12(20-10)13(19)18(5-3-15)6-4-16/h1-2,7H,5-6,17H2 |
| InChIKey | PYTUWCBXZUJVLB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 93.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|