C15H18N2O3S — CID 103358748
(3-amino-6-methoxy-1-benzothiophen-2-yl)-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone (PubChem CID 103358748) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is (3-amino-6-methoxy-1-benzothiophen-2-yl)-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone.
| Compound Name | (3-amino-6-methoxy-1-benzothiophen-2-yl)-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 103358748 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (3-amino-6-methoxy-1-benzothiophen-2-yl)-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone |
| SMILES | COc1ccc2c(N)c(C(=O)N3CCC(C)(O)C3)sc2c1 |
| InChI | InChI=1S/C15H18N2O3S/c1-15(19)5-6-17(8-15)14(18)13-12(16)10-4-3-9(20-2)7-11(10)21-13/h3-4,7,19H,5-6,8,16H2,1-2H3 |
| InChIKey | PVIHFEPQICFHDG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |