C16H20N2O2S — CID 107932583
(3-amino-5-methyl-1-benzothiophen-2-yl)-(3-hydroxy-3-methylpiperidin-1-yl)methanone (PubChem CID 107932583) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is (3-amino-5-methyl-1-benzothiophen-2-yl)-(3-hydroxy-3-methylpiperidin-1-yl)methanone.
| Compound Name | (3-amino-5-methyl-1-benzothiophen-2-yl)-(3-hydroxy-3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 107932583 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (3-amino-5-methyl-1-benzothiophen-2-yl)-(3-hydroxy-3-methylpiperidin-1-yl)methanone |
| SMILES | Cc1ccc2sc(C(=O)N3CCCC(C)(O)C3)c(N)c2c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-10-4-5-12-11(8-10)13(17)14(21-12)15(19)18-7-3-6-16(2,20)9-18/h4-5,8,20H,3,6-7,9,17H2,1-2H3 |
| InChIKey | HXRCPNRCVZRUTL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |