C41H50BNO6 — CID 56929963
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl N-[4-[bis[(2-methyl-1-phenylpropan-2-yl)oxy]methyl]phenyl]carbamate (PubChem CID 56929963) has the molecular formula C41H50BNO6 and a molecular weight of 663.66 g/mol. Its IUPAC name is [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl N-[4-[bis[(2-methyl-1-phenylpropan-2-yl)oxy]methyl]phenyl]carbamate.
| Compound Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl N-[4-[bis[(2-methyl-1-phenylpropan-2-yl)oxy]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 56929963 |
| Molecular Formula | C41H50BNO6 |
| Molecular Weight | 663.66 g/mol |
| Exact Mass | 663.37 |
| IUPAC Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl N-[4-[bis[(2-methyl-1-phenylpropan-2-yl)oxy]methyl]phenyl]carbamate |
| SMILES | CC(C)(Cc1ccccc1)OC(OC(C)(C)Cc1ccccc1)c1ccc(NC(=O)OCc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C41H50BNO6/c1-38(2,27-30-15-11-9-12-16-30)46-36(47-39(3,4)28-31-17-13-10-14-18-31)33-21-25-35(26-22-33)43-37(44)45-29-32-19-23-34(24-20-32)42-48-40(5,6)41(7,8)49-42/h9-26,36H,27-29H2,1-8H3,(H,43,44) |
| InChIKey | WBTMWUZMHQENBV-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.66 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|