C37H39BN4O11 — CID 71658422
[4-[[4-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxycarbonylamino]phenyl]methoxycarbonylamino]phenyl]methyl N-(4-nitrophenyl)carbamate (PubChem CID 71658422) has the molecular formula C37H39BN4O11 and a molecular weight of 726.55 g/mol. Its IUPAC name is [4-[[4-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxycarbonylamino]phenyl]methoxycarbonylamino]phenyl]methyl N-(4-nitrophenyl)carbamate.
| Compound Name | [4-[[4-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxycarbonylamino]phenyl]methoxycarbonylamino]phenyl]methyl N-(4-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 71658422 |
| Molecular Formula | C37H39BN4O11 |
| Molecular Weight | 726.55 g/mol |
| Exact Mass | 726.27 |
| IUPAC Name | [4-[[4-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxycarbonylamino]phenyl]methoxycarbonylamino]phenyl]methyl N-(4-nitrophenyl)carbamate |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)ccc1COC(=O)Nc1ccc(COC(=O)Nc2ccc(COC(=O)Nc3ccc([N+](=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C37H39BN4O11/c1-36(2)37(3,4)53-38(52-36)27-11-10-26(32(20-27)48-5)23-51-35(45)40-29-14-8-25(9-15-29)21-49-33(43)39-28-12-6-24(7-13-28)22-50-34(44)41-30-16-18-31(19-17-30)42(46)47/h6-20H,21-23H2,1-5H3,(H,39,43)(H,40,45)(H,41,44) |
| InChIKey | DFWIXICEWSUFLX-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 185.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.55 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|