C22H26BNO6S — CID 170812428
4-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophene-2-carboxylic acid (PubChem CID 170812428) has the molecular formula C22H26BNO6S and a molecular weight of 443.33 g/mol. Its IUPAC name is 4-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 170812428 |
| Molecular Formula | C22H26BNO6S |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 4-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophene-2-carboxylic acid |
| SMILES | CC1(C)OB(C(=Cc2csc(C(=O)O)c2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C22H26BNO6S/c1-21(2)22(3,4)30-23(29-21)17(10-16-11-18(19(25)26)31-14-16)12-24-20(27)28-13-15-8-6-5-7-9-15/h5-11,14H,12-13H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | NKHXDDWHFLNDIL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|