C24H30BNO6S — CID 170813088
benzyl N-[3-(3-methylsulfonylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813088) has the molecular formula C24H30BNO6S and a molecular weight of 471.38 g/mol. Its IUPAC name is benzyl N-[3-(3-methylsulfonylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(3-methylsulfonylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813088 |
| Molecular Formula | C24H30BNO6S |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | benzyl N-[3-(3-methylsulfonylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cccc(S(C)(=O)=O)c2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C24H30BNO6S/c1-23(2)24(3,4)32-25(31-23)20(14-19-12-9-13-21(15-19)33(5,28)29)16-26-22(27)30-17-18-10-7-6-8-11-18/h6-15H,16-17H2,1-5H3,(H,26,27) |
| InChIKey | JAALXMBOJMKGGF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|