C35H44BNO7 — CID 58754174
benzyl (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate (PubChem CID 58754174) has the molecular formula C35H44BNO7 and a molecular weight of 601.55 g/mol. Its IUPAC name is benzyl (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate.
| Compound Name | benzyl (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 58754174 |
| Molecular Formula | C35H44BNO7 |
| Molecular Weight | 601.55 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | benzyl (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H](Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H44BNO7/c1-33(2,3)42-32(39)37(8)29(31(38)41-24-26-17-13-10-14-18-26)22-27-21-28(36-43-34(4,5)35(6,7)44-36)19-20-30(27)40-23-25-15-11-9-12-16-25/h9-21,29H,22-24H2,1-8H3/t29-/m0/s1 |
| InChIKey | LQNDJUJWFVHLGC-LJAQVGFWSA-N |
| XLogP | 6.09 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|