C19H20BrFN2O3S — CID 16593876
1-[4-[4-[(2-bromo-4-fluorophenyl)methyl]piperazin-1-yl]sulfonylphenyl]ethanone (PubChem CID 16593876) has the molecular formula C19H20BrFN2O3S and a molecular weight of 455.35 g/mol. Its IUPAC name is 1-[4-[4-[(2-bromo-4-fluorophenyl)methyl]piperazin-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[4-[4-[(2-bromo-4-fluorophenyl)methyl]piperazin-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 16593876 |
| Molecular Formula | C19H20BrFN2O3S |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | 1-[4-[4-[(2-bromo-4-fluorophenyl)methyl]piperazin-1-yl]sulfonylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCN(Cc3ccc(F)cc3Br)CC2)cc1 |
| InChI | InChI=1S/C19H20BrFN2O3S/c1-14(24)15-3-6-18(7-4-15)27(25,26)23-10-8-22(9-11-23)13-16-2-5-17(21)12-19(16)20/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | DHHKNAFJQYCJPO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |