C16H26ClNO3S — CID 70481406
4-tert-butyl-2-methylsulfonyl-6-(pyrrolidin-1-ylmethyl)phenol;hydrochloride (PubChem CID 70481406) has the molecular formula C16H26ClNO3S and a molecular weight of 347.91 g/mol. Its IUPAC name is 4-tert-butyl-2-methylsulfonyl-6-(pyrrolidin-1-ylmethyl)phenol;hydrochloride.
| Compound Name | 4-tert-butyl-2-methylsulfonyl-6-(pyrrolidin-1-ylmethyl)phenol;hydrochloride |
|---|---|
| PubChem CID | 70481406 |
| Molecular Formula | C16H26ClNO3S |
| Molecular Weight | 347.91 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-tert-butyl-2-methylsulfonyl-6-(pyrrolidin-1-ylmethyl)phenol;hydrochloride |
| SMILES | CC(C)(C)c1cc(CN2CCCC2)c(O)c(S(C)(=O)=O)c1.Cl |
| InChI | InChI=1S/C16H25NO3S.ClH/c1-16(2,3)13-9-12(11-17-7-5-6-8-17)15(18)14(10-13)21(4,19)20;/h9-10,18H,5-8,11H2,1-4H3;1H |
| InChIKey | CQCNWEQZHPMOGM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.91 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|