C19H31N3O — CID 15687088
2-amino-3-methyl-4,6-bis(piperidin-1-ylmethyl)phenol (PubChem CID 15687088) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is 2-amino-3-methyl-4,6-bis(piperidin-1-ylmethyl)phenol.
| Compound Name | 2-amino-3-methyl-4,6-bis(piperidin-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 15687088 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 2-amino-3-methyl-4,6-bis(piperidin-1-ylmethyl)phenol |
| SMILES | Cc1c(CN2CCCCC2)cc(CN2CCCCC2)c(O)c1N |
| InChI | InChI=1S/C19H31N3O/c1-15-16(13-21-8-4-2-5-9-21)12-17(19(23)18(15)20)14-22-10-6-3-7-11-22/h12,23H,2-11,13-14,20H2,1H3 |
| InChIKey | IXAHVSSYXWSXRT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|