C16H21NO3 — CID 156715882
2,4-dihydroxy-N,6-dimethyl-3-(3-methylcyclohex-2-en-1-yl)benzamide (PubChem CID 156715882) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2,4-dihydroxy-N,6-dimethyl-3-(3-methylcyclohex-2-en-1-yl)benzamide.
| Compound Name | 2,4-dihydroxy-N,6-dimethyl-3-(3-methylcyclohex-2-en-1-yl)benzamide |
|---|---|
| PubChem CID | 156715882 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2,4-dihydroxy-N,6-dimethyl-3-(3-methylcyclohex-2-en-1-yl)benzamide |
| SMILES | CNC(=O)c1c(C)cc(O)c(C2C=C(C)CCC2)c1O |
| InChI | InChI=1S/C16H21NO3/c1-9-5-4-6-11(7-9)14-12(18)8-10(2)13(15(14)19)16(20)17-3/h7-8,11,18-19H,4-6H2,1-3H3,(H,17,20) |
| InChIKey | QAUROAZMMUOKQQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|