C25H29NO5 — CID 156715874
methyl (2S)-2-[[2,4-dihydroxy-6-methyl-3-(3-methylcyclohex-2-en-1-yl)benzoyl]amino]-3-phenylpropanoate (PubChem CID 156715874) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is methyl (2S)-2-[[2,4-dihydroxy-6-methyl-3-(3-methylcyclohex-2-en-1-yl)benzoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[2,4-dihydroxy-6-methyl-3-(3-methylcyclohex-2-en-1-yl)benzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 156715874 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | methyl (2S)-2-[[2,4-dihydroxy-6-methyl-3-(3-methylcyclohex-2-en-1-yl)benzoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)c1c(C)cc(O)c(C2C=C(C)CCC2)c1O |
| InChI | InChI=1S/C25H29NO5/c1-15-8-7-11-18(12-15)22-20(27)13-16(2)21(23(22)28)24(29)26-19(25(30)31-3)14-17-9-5-4-6-10-17/h4-6,9-10,12-13,18-19,27-28H,7-8,11,14H2,1-3H3,(H,26,29)/t18?,19-/m0/s1 |
| InChIKey | NWDKCVVSOWATIB-GGYWPGCISA-N |
| XLogP | 4.13 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|