C21H30N2O2 — CID 164531177
5-[(Z)-1-amino-3-ethyliminoprop-1-en-2-yl]-2-(3-methylcyclohex-2-en-1-yl)benzene-1,3-diol;prop-1-ene (PubChem CID 164531177) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 5-[(Z)-1-amino-3-ethyliminoprop-1-en-2-yl]-2-(3-methylcyclohex-2-en-1-yl)benzene-1,3-diol;prop-1-ene.
| Compound Name | 5-[(Z)-1-amino-3-ethyliminoprop-1-en-2-yl]-2-(3-methylcyclohex-2-en-1-yl)benzene-1,3-diol;prop-1-ene |
|---|---|
| PubChem CID | 164531177 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 5-[(Z)-1-amino-3-ethyliminoprop-1-en-2-yl]-2-(3-methylcyclohex-2-en-1-yl)benzene-1,3-diol;prop-1-ene |
| SMILES | C=CC.CC/N=C/C(=C\N)c1cc(O)c(C2C=C(C)CCC2)c(O)c1 |
| InChI | InChI=1S/C18H24N2O2.C3H6/c1-3-20-11-15(10-19)14-8-16(21)18(17(22)9-14)13-6-4-5-12(2)7-13;1-3-2/h7-11,13,21-22H,3-6,19H2,1-2H3;3H,1H2,2H3/b15-10+,20-11+; |
| InChIKey | ATVSJWWCTITERX-JZHHHKINSA-N |
| XLogP | 4.89 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|