C23H28O3S — CID 155724421
2-(3-methylcyclohex-2-en-1-yl)-5-(4-methylphenyl)sulfanyloxybenzene-1,3-diol;prop-1-ene (PubChem CID 155724421) has the molecular formula C23H28O3S and a molecular weight of 384.54 g/mol. Its IUPAC name is 2-(3-methylcyclohex-2-en-1-yl)-5-(4-methylphenyl)sulfanyloxybenzene-1,3-diol;prop-1-ene.
| Compound Name | 2-(3-methylcyclohex-2-en-1-yl)-5-(4-methylphenyl)sulfanyloxybenzene-1,3-diol;prop-1-ene |
|---|---|
| PubChem CID | 155724421 |
| Molecular Formula | C23H28O3S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-(3-methylcyclohex-2-en-1-yl)-5-(4-methylphenyl)sulfanyloxybenzene-1,3-diol;prop-1-ene |
| SMILES | C=CC.CC1=CC(c2c(O)cc(OSc3ccc(C)cc3)cc2O)CCC1 |
| InChI | InChI=1S/C20H22O3S.C3H6/c1-13-6-8-17(9-7-13)24-23-16-11-18(21)20(19(22)12-16)15-5-3-4-14(2)10-15;1-3-2/h6-12,15,21-22H,3-5H2,1-2H3;3H,1H2,2H3 |
| InChIKey | OGDXZOBKYQDEHY-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|