C31H46N2O2 — CID 172579152
ethane;5-ethyl-2-(3-methylcyclohex-2-en-1-yl)-4-[(4-phenylpiperazin-1-yl)methyl]benzene-1,3-diol;prop-1-ene (PubChem CID 172579152) has the molecular formula C31H46N2O2 and a molecular weight of 478.72 g/mol. Its IUPAC name is ethane;5-ethyl-2-(3-methylcyclohex-2-en-1-yl)-4-[(4-phenylpiperazin-1-yl)methyl]benzene-1,3-diol;prop-1-ene.
| Compound Name | ethane;5-ethyl-2-(3-methylcyclohex-2-en-1-yl)-4-[(4-phenylpiperazin-1-yl)methyl]benzene-1,3-diol;prop-1-ene |
|---|---|
| PubChem CID | 172579152 |
| Molecular Formula | C31H46N2O2 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.36 |
| IUPAC Name | ethane;5-ethyl-2-(3-methylcyclohex-2-en-1-yl)-4-[(4-phenylpiperazin-1-yl)methyl]benzene-1,3-diol;prop-1-ene |
| SMILES | C=CC.CC.CCc1cc(O)c(C2C=C(C)CCC2)c(O)c1CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H34N2O2.C3H6.C2H6/c1-3-20-17-24(29)25(21-9-7-8-19(2)16-21)26(30)23(20)18-27-12-14-28(15-13-27)22-10-5-4-6-11-22;1-3-2;1-2/h4-6,10-11,16-17,21,29-30H,3,7-9,12-15,18H2,1-2H3;3H,1H2,2H3;1-2H3 |
| InChIKey | XYRXSXHLQVNWOY-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|