C26H31NO2 — CID 155575473
4-(1H-indol-2-yl)-2-(3-methylcyclohex-2-en-1-yl)-5-pentylbenzene-1,3-diol (PubChem CID 155575473) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is 4-(1H-indol-2-yl)-2-(3-methylcyclohex-2-en-1-yl)-5-pentylbenzene-1,3-diol.
| Compound Name | 4-(1H-indol-2-yl)-2-(3-methylcyclohex-2-en-1-yl)-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 155575473 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 4-(1H-indol-2-yl)-2-(3-methylcyclohex-2-en-1-yl)-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(O)c1-c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H31NO2/c1-3-4-5-11-20-16-23(28)25(19-12-8-9-17(2)14-19)26(29)24(20)22-15-18-10-6-7-13-21(18)27-22/h6-7,10,13-16,19,27-29H,3-5,8-9,11-12H2,1-2H3 |
| InChIKey | ICFGKQLZIJNUSF-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|