C28H33N3O7 — CID 149088517
(6aR,10aR)-N-(2,4-dinitrophenyl)-1-hydroxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxamide (PubChem CID 149088517) has the molecular formula C28H33N3O7 and a molecular weight of 523.59 g/mol. Its IUPAC name is (6aR,10aR)-N-(2,4-dinitrophenyl)-1-hydroxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxamide.
| Compound Name | (6aR,10aR)-N-(2,4-dinitrophenyl)-1-hydroxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 149088517 |
| Molecular Formula | C28H33N3O7 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | (6aR,10aR)-N-(2,4-dinitrophenyl)-1-hydroxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxamide |
| SMILES | CCCCCc1cc2c(c(O)c1C(=O)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])[C@@H]1C=C(C)CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C28H33N3O7/c1-5-6-7-8-17-14-23-25(19-13-16(2)9-11-20(19)28(3,4)38-23)26(32)24(17)27(33)29-21-12-10-18(30(34)35)15-22(21)31(36)37/h10,12-15,19-20,32H,5-9,11H2,1-4H3,(H,29,33)/t19-,20-/m1/s1 |
| InChIKey | QRSMTUUFMNQVTD-WOJBJXKFSA-N |
| XLogP | 6.80 |
| TPSA | 144.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|