C23H29O6P — CID 155575501
2-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxypropan-2-yl dihydrogen phosphate (PubChem CID 155575501) has the molecular formula C23H29O6P and a molecular weight of 432.45 g/mol. Its IUPAC name is 2-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxypropan-2-yl dihydrogen phosphate.
| Compound Name | 2-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxypropan-2-yl dihydrogen phosphate |
|---|---|
| PubChem CID | 155575501 |
| Molecular Formula | C23H29O6P |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxypropan-2-yl dihydrogen phosphate |
| SMILES | C=C1Oc2cc(CCCCC)cc(OC(C)(C)OP(=O)(O)O)c2-c2cc(C)ccc21 |
| InChI | InChI=1S/C23H29O6P/c1-6-7-8-9-17-13-20-22(19-12-15(2)10-11-18(19)16(3)27-20)21(14-17)28-23(4,5)29-30(24,25)26/h10-14H,3,6-9H2,1-2,4-5H3,(H2,24,25,26) |
| InChIKey | TWTCKPQMSVGVCA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|