C22H29O4P — CID 155575798
1-[2-(3-methylphenyl)-5-pentylphenoxy]phosphanyloxyethyl acetate (PubChem CID 155575798) has the molecular formula C22H29O4P and a molecular weight of 388.44 g/mol. Its IUPAC name is 1-[2-(3-methylphenyl)-5-pentylphenoxy]phosphanyloxyethyl acetate.
| Compound Name | 1-[2-(3-methylphenyl)-5-pentylphenoxy]phosphanyloxyethyl acetate |
|---|---|
| PubChem CID | 155575798 |
| Molecular Formula | C22H29O4P |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-[2-(3-methylphenyl)-5-pentylphenoxy]phosphanyloxyethyl acetate |
| SMILES | CCCCCc1ccc(-c2cccc(C)c2)c(OPOC(C)OC(C)=O)c1 |
| InChI | InChI=1S/C22H29O4P/c1-5-6-7-10-19-12-13-21(20-11-8-9-16(2)14-20)22(15-19)26-27-25-18(4)24-17(3)23/h8-9,11-15,18,27H,5-7,10H2,1-4H3 |
| InChIKey | YBFLNLJBCYHNJZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|