C23H37NO4 — CID 156648730
1,3-dimethoxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylbenzene;N-methoxy-N-methylformamide (PubChem CID 156648730) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is 1,3-dimethoxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylbenzene;N-methoxy-N-methylformamide.
| Compound Name | 1,3-dimethoxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylbenzene;N-methoxy-N-methylformamide |
|---|---|
| PubChem CID | 156648730 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 1,3-dimethoxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylbenzene;N-methoxy-N-methylformamide |
| SMILES | CCCCCc1cc(OC)c(C2C=C(C)CCC2)c(OC)c1.CON(C)C=O |
| InChI | InChI=1S/C20H30O2.C3H7NO2/c1-5-6-7-10-16-13-18(21-3)20(19(14-16)22-4)17-11-8-9-15(2)12-17;1-4(3-5)6-2/h12-14,17H,5-11H2,1-4H3;3H,1-2H3 |
| InChIKey | LLCZQFXYEYSOKM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|