C36H64O10P2 — CID 155575520
[3-[bis(2-methylpropoxy)phosphoryloxymethoxy]-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]methyl tert-butyl 2-methylpropyl phosphate (PubChem CID 155575520) has the molecular formula C36H64O10P2 and a molecular weight of 718.85 g/mol. Its IUPAC name is [3-[bis(2-methylpropoxy)phosphoryloxymethoxy]-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]methyl tert-butyl 2-methylpropyl phosphate.
| Compound Name | [3-[bis(2-methylpropoxy)phosphoryloxymethoxy]-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]methyl tert-butyl 2-methylpropyl phosphate |
|---|---|
| PubChem CID | 155575520 |
| Molecular Formula | C36H64O10P2 |
| Molecular Weight | 718.85 g/mol |
| Exact Mass | 718.40 |
| IUPAC Name | [3-[bis(2-methylpropoxy)phosphoryloxymethoxy]-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]methyl tert-butyl 2-methylpropyl phosphate |
| SMILES | CCCCCc1cc(OCOP(=O)(OCC(C)C)OCC(C)C)c(C2C=C(C)CCC2)c(OCOP(=O)(OCC(C)C)OC(C)(C)C)c1 |
| InChI | InChI=1S/C36H64O10P2/c1-12-13-14-17-31-20-33(39-25-44-47(37,41-22-27(2)3)42-23-28(4)5)35(32-18-15-16-30(8)19-32)34(21-31)40-26-45-48(38,43-24-29(6)7)46-36(9,10)11/h19-21,27-29,32H,12-18,22-26H2,1-11H3 |
| InChIKey | KZYPOJKFRHRMOQ-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.85 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|