C28H37FN2O5 — CID 156727249
[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(5-fluoro-2,4-dioxopyrimidin-1-yl)propanoate;prop-1-ene (PubChem CID 156727249) has the molecular formula C28H37FN2O5 and a molecular weight of 500.61 g/mol. Its IUPAC name is [3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(5-fluoro-2,4-dioxopyrimidin-1-yl)propanoate;prop-1-ene.
| Compound Name | [3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(5-fluoro-2,4-dioxopyrimidin-1-yl)propanoate;prop-1-ene |
|---|---|
| PubChem CID | 156727249 |
| Molecular Formula | C28H37FN2O5 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | [3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(5-fluoro-2,4-dioxopyrimidin-1-yl)propanoate;prop-1-ene |
| SMILES | C=CC.CCCCCc1cc(O)c(C2C=C(C)CCC2)c(OC(=O)CCn2cc(F)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C25H31FN2O5.C3H6/c1-3-4-5-8-17-13-20(29)23(18-9-6-7-16(2)12-18)21(14-17)33-22(30)10-11-28-15-19(26)24(31)27-25(28)32;1-3-2/h12-15,18,29H,3-11H2,1-2H3,(H,27,31,32);3H,1H2,2H3 |
| InChIKey | YQWSULTWUVJCTO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|