C17H24O2S2 — CID 176573198
5-propyl-2-[(1S)-3-sulfanylcyclohex-2-en-1-yl]-3-(1-sulfanylethoxy)phenol (PubChem CID 176573198) has the molecular formula C17H24O2S2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 5-propyl-2-[(1S)-3-sulfanylcyclohex-2-en-1-yl]-3-(1-sulfanylethoxy)phenol.
| Compound Name | 5-propyl-2-[(1S)-3-sulfanylcyclohex-2-en-1-yl]-3-(1-sulfanylethoxy)phenol |
|---|---|
| PubChem CID | 176573198 |
| Molecular Formula | C17H24O2S2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 5-propyl-2-[(1S)-3-sulfanylcyclohex-2-en-1-yl]-3-(1-sulfanylethoxy)phenol |
| SMILES | CCCc1cc(O)c([C@@H]2C=C(S)CCC2)c(OC(C)S)c1 |
| InChI | InChI=1S/C17H24O2S2/c1-3-5-12-8-15(18)17(16(9-12)19-11(2)20)13-6-4-7-14(21)10-13/h8-11,13,18,20-21H,3-7H2,1-2H3/t11?,13-/m0/s1 |
| InChIKey | GHGJTOBSDGHWMO-YUZLPWPTSA-N |
| XLogP | 5.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|