C25H37N — CID 156825398
4-ethenyl-5-(3-methylcyclohex-2-en-1-yl)-3,6-dimethylidene-2-pentyl-N-propan-2-ylcyclohexa-1,4-dien-1-amine (PubChem CID 156825398) has the molecular formula C25H37N and a molecular weight of 351.58 g/mol. Its IUPAC name is 4-ethenyl-5-(3-methylcyclohex-2-en-1-yl)-3,6-dimethylidene-2-pentyl-N-propan-2-ylcyclohexa-1,4-dien-1-amine.
| Compound Name | 4-ethenyl-5-(3-methylcyclohex-2-en-1-yl)-3,6-dimethylidene-2-pentyl-N-propan-2-ylcyclohexa-1,4-dien-1-amine |
|---|---|
| PubChem CID | 156825398 |
| Molecular Formula | C25H37N |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | 4-ethenyl-5-(3-methylcyclohex-2-en-1-yl)-3,6-dimethylidene-2-pentyl-N-propan-2-ylcyclohexa-1,4-dien-1-amine |
| SMILES | C=Cc1c(C2C=C(C)CCC2)c(=C)c(NC(C)C)c(CCCCC)c1=C |
| InChI | InChI=1S/C25H37N/c1-8-10-11-15-23-19(6)22(9-2)24(20(7)25(23)26-17(3)4)21-14-12-13-18(5)16-21/h9,16-17,21,26H,2,6-8,10-15H2,1,3-5H3 |
| InChIKey | YVPBZUODAZUDLV-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|