C30H45N — CID 177210325
N-[(Z,2E)-2-ethylidenepent-3-enyl]-5-(3-methylcyclohex-2-en-1-yl)-3,6-dimethylidene-2-pentylcyclohexa-1,4-dien-1-amine;prop-1-ene (PubChem CID 177210325) has the molecular formula C30H45N and a molecular weight of 419.70 g/mol. Its IUPAC name is N-[(Z,2E)-2-ethylidenepent-3-enyl]-5-(3-methylcyclohex-2-en-1-yl)-3,6-dimethylidene-2-pentylcyclohexa-1,4-dien-1-amine;prop-1-ene.
| Compound Name | N-[(Z,2E)-2-ethylidenepent-3-enyl]-5-(3-methylcyclohex-2-en-1-yl)-3,6-dimethylidene-2-pentylcyclohexa-1,4-dien-1-amine;prop-1-ene |
|---|---|
| PubChem CID | 177210325 |
| Molecular Formula | C30H45N |
| Molecular Weight | 419.70 g/mol |
| Exact Mass | 419.36 |
| IUPAC Name | N-[(Z,2E)-2-ethylidenepent-3-enyl]-5-(3-methylcyclohex-2-en-1-yl)-3,6-dimethylidene-2-pentylcyclohexa-1,4-dien-1-amine;prop-1-ene |
| SMILES | C=CC.C=c1cc(C2C=C(C)CCC2)c(=C)c(NCC(/C=C\C)=C/C)c1CCCCC |
| InChI | InChI=1S/C27H39N.C3H6/c1-7-10-11-16-25-21(5)18-26(24-15-12-14-20(4)17-24)22(6)27(25)28-19-23(9-3)13-8-2;1-3-2/h8-9,13,17-18,24,28H,5-7,10-12,14-16,19H2,1-4H3;3H,1H2,2H3/b13-8-,23-9+; |
| InChIKey | QRZSRAHQLGDDPI-YFVNBRBZSA-N |
| XLogP | 7.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.70 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|