C24H37N — CID 156825393
N-methyl-5-(3-methylcyclohex-2-en-1-yl)-3,6-dimethylidene-2-pentylcyclohexa-1,4-dien-1-amine;prop-1-ene (PubChem CID 156825393) has the molecular formula C24H37N and a molecular weight of 339.57 g/mol. Its IUPAC name is N-methyl-5-(3-methylcyclohex-2-en-1-yl)-3,6-dimethylidene-2-pentylcyclohexa-1,4-dien-1-amine;prop-1-ene.
| Compound Name | N-methyl-5-(3-methylcyclohex-2-en-1-yl)-3,6-dimethylidene-2-pentylcyclohexa-1,4-dien-1-amine;prop-1-ene |
|---|---|
| PubChem CID | 156825393 |
| Molecular Formula | C24H37N |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | N-methyl-5-(3-methylcyclohex-2-en-1-yl)-3,6-dimethylidene-2-pentylcyclohexa-1,4-dien-1-amine;prop-1-ene |
| SMILES | C=CC.C=c1cc(C2C=C(C)CCC2)c(=C)c(NC)c1CCCCC |
| InChI | InChI=1S/C21H31N.C3H6/c1-6-7-8-12-19-16(3)14-20(17(4)21(19)22-5)18-11-9-10-15(2)13-18;1-3-2/h13-14,18,22H,3-4,6-12H2,1-2,5H3;3H,1H2,2H3 |
| InChIKey | GBKIREPYAZNYBW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|