C33H43NO3 — CID 155748637
[3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(1-benzylaziridin-2-yl)propanoate (PubChem CID 155748637) has the molecular formula C33H43NO3 and a molecular weight of 501.71 g/mol. Its IUPAC name is [3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(1-benzylaziridin-2-yl)propanoate.
| Compound Name | [3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(1-benzylaziridin-2-yl)propanoate |
|---|---|
| PubChem CID | 155748637 |
| Molecular Formula | C33H43NO3 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | [3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(1-benzylaziridin-2-yl)propanoate |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(O)cc(CCCCC)cc1OC(=O)CCC1CN1Cc1ccccc1 |
| InChI | InChI=1S/C33H43NO3/c1-5-6-8-13-26-19-30(35)33(29-18-24(4)14-16-28(29)23(2)3)31(20-26)37-32(36)17-15-27-22-34(27)21-25-11-9-7-10-12-25/h7,9-12,18-20,27-29,35H,2,5-6,8,13-17,21-22H2,1,3-4H3 |
| InChIKey | SPKDVGWNYCOWKA-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|