C36H43O7P — CID 177092549
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-[hydroxy(phenylmethoxy)phosphoryl]oxy-2-phenylacetate (PubChem CID 177092549) has the molecular formula C36H43O7P and a molecular weight of 618.71 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-[hydroxy(phenylmethoxy)phosphoryl]oxy-2-phenylacetate.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-[hydroxy(phenylmethoxy)phosphoryl]oxy-2-phenylacetate |
|---|---|
| PubChem CID | 177092549 |
| Molecular Formula | C36H43O7P |
| Molecular Weight | 618.71 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-[hydroxy(phenylmethoxy)phosphoryl]oxy-2-phenylacetate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)C(OP(=O)(O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H43O7P/c1-5-6-9-16-28-22-32(37)34(31-21-26(4)19-20-30(31)25(2)3)33(23-28)42-36(38)35(29-17-12-8-13-18-29)43-44(39,40)41-24-27-14-10-7-11-15-27/h7-8,10-15,17-18,21-23,30-31,35,37H,2,5-6,9,16,19-20,24H2,1,3-4H3,(H,39,40)/t30-,31+,35?/m0/s1 |
| InChIKey | LWXXJMLTNDASJL-ZWGMHZRLSA-N |
| XLogP | 9.12 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.71 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|