C34H46NO7P — CID 166645610
benzyl (2S)-2-[[ethoxycarbonyl-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]phosphoryl]amino]propanoate (PubChem CID 166645610) has the molecular formula C34H46NO7P and a molecular weight of 611.72 g/mol. Its IUPAC name is benzyl (2S)-2-[[ethoxycarbonyl-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]phosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[ethoxycarbonyl-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166645610 |
| Molecular Formula | C34H46NO7P |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.30 |
| IUPAC Name | benzyl (2S)-2-[[ethoxycarbonyl-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]phosphoryl]amino]propanoate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OP(=O)(N[C@@H](C)C(=O)OCc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C34H46NO7P/c1-7-9-11-16-27-20-30(36)32(29-19-24(5)17-18-28(29)23(3)4)31(21-27)42-43(39,34(38)40-8-2)35-25(6)33(37)41-22-26-14-12-10-13-15-26/h10,12-15,19-21,25,28-29,36H,3,7-9,11,16-18,22H2,1-2,4-6H3,(H,35,39)/t25-,28-,29+,43?/m0/s1 |
| InChIKey | VHJCGKHBUXAVRN-UMUPHKRYSA-N |
| XLogP | 8.59 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|