C30H44B2NO7P — CID 174032083
CID 174032083 (PubChem CID 174032083) has the molecular formula C30H44B2NO7P and a molecular weight of 583.28 g/mol.
| Compound Name | CID 174032083 |
|---|---|
| PubChem CID | 174032083 |
| Molecular Formula | C30H44B2NO7P |
| Molecular Weight | 583.28 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | — |
| SMILES | [B]C([B])(C)CCCc1cc(O)c(C2C=C(C)CCC2C(=C)C)c(OP(=O)(NC(C)C(=O)OC(C)C)C(=O)OCC)c1 |
| InChI | InChI=1S/C30H44B2NO7P/c1-9-38-29(36)41(37,33-21(7)28(35)39-19(4)5)40-26-17-22(11-10-14-30(8,31)32)16-25(34)27(26)24-15-20(6)12-13-23(24)18(2)3/h15-17,19,21,23-24,34H,2,9-14H2,1,3-8H3,(H,33,37) |
| InChIKey | RRDXHAQSFIAKJD-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.28 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|