C26H39O8P — CID 177092664
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 2-ethoxy-2-[hydroxy(propan-2-yloxy)phosphoryl]oxyacetate (PubChem CID 177092664) has the molecular formula C26H39O8P and a molecular weight of 510.56 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 2-ethoxy-2-[hydroxy(propan-2-yloxy)phosphoryl]oxyacetate.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 2-ethoxy-2-[hydroxy(propan-2-yloxy)phosphoryl]oxyacetate |
|---|---|
| PubChem CID | 177092664 |
| Molecular Formula | C26H39O8P |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 2-ethoxy-2-[hydroxy(propan-2-yloxy)phosphoryl]oxyacetate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCC)cc1OC(=O)C(OCC)OP(=O)(O)OC(C)C |
| InChI | InChI=1S/C26H39O8P/c1-8-10-19-14-22(27)24(21-13-18(7)11-12-20(21)16(3)4)23(15-19)32-25(28)26(31-9-2)34-35(29,30)33-17(5)6/h13-15,17,20-21,26-27H,3,8-12H2,1-2,4-7H3,(H,29,30)/t20-,21+,26?/m0/s1 |
| InChIKey | ZBWJBGBMCLTBCX-IEDSLXKASA-N |
| XLogP | 6.17 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|