C27H40NO7P — CID 166644595
2-[[ethoxycarbonyl-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]phosphoryl]amino]propanoic acid (PubChem CID 166644595) has the molecular formula C27H40NO7P and a molecular weight of 521.59 g/mol. Its IUPAC name is 2-[[ethoxycarbonyl-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]phosphoryl]amino]propanoic acid.
| Compound Name | 2-[[ethoxycarbonyl-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]phosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 166644595 |
| Molecular Formula | C27H40NO7P |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 2-[[ethoxycarbonyl-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]phosphoryl]amino]propanoic acid |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OP(=O)(NC(C)C(=O)O)C(=O)OCC |
| InChI | InChI=1S/C27H40NO7P/c1-7-9-10-11-20-15-23(29)25(22-14-18(5)12-13-21(22)17(3)4)24(16-20)35-36(33,27(32)34-8-2)28-19(6)26(30)31/h14-16,19,21-22,29H,3,7-13H2,1-2,4-6H3,(H,28,33)(H,30,31)/t19?,21-,22+,36?/m0/s1 |
| InChIKey | CRHDHYRPYQHIPV-ABJSYMGQSA-N |
| XLogP | 6.93 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|