C28H42NO7P — CID 166644598
2-[[ethoxycarbonyl-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]phosphoryl]amino]-2-methylpropanoic acid (PubChem CID 166644598) has the molecular formula C28H42NO7P and a molecular weight of 535.62 g/mol. Its IUPAC name is 2-[[ethoxycarbonyl-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]phosphoryl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[ethoxycarbonyl-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]phosphoryl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 166644598 |
| Molecular Formula | C28H42NO7P |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | 2-[[ethoxycarbonyl-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]phosphoryl]amino]-2-methylpropanoic acid |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OP(=O)(NC(C)(C)C(=O)O)C(=O)OCC |
| InChI | InChI=1S/C28H42NO7P/c1-8-10-11-12-20-16-23(30)25(22-15-19(5)13-14-21(22)18(3)4)24(17-20)36-37(34,27(33)35-9-2)29-28(6,7)26(31)32/h15-17,21-22,30H,3,8-14H2,1-2,4-7H3,(H,29,34)(H,31,32)/t21-,22+,37?/m0/s1 |
| InChIKey | BHWAFVIOJAHSJS-IRUROBEVSA-N |
| XLogP | 7.32 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|