C29H44NO7P — CID 177092718
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 1-[2-(dimethylamino)ethoxy-hydroxyphosphoryl]oxycyclopentane-1-carboxylate (PubChem CID 177092718) has the molecular formula C29H44NO7P and a molecular weight of 549.65 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 1-[2-(dimethylamino)ethoxy-hydroxyphosphoryl]oxycyclopentane-1-carboxylate.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 1-[2-(dimethylamino)ethoxy-hydroxyphosphoryl]oxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 177092718 |
| Molecular Formula | C29H44NO7P |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 1-[2-(dimethylamino)ethoxy-hydroxyphosphoryl]oxycyclopentane-1-carboxylate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCC)cc1OC(=O)C1(OP(=O)(O)OCCN(C)C)CCCC1 |
| InChI | InChI=1S/C29H44NO7P/c1-7-10-22-18-25(31)27(24-17-21(4)11-12-23(24)20(2)3)26(19-22)36-28(32)29(13-8-9-14-29)37-38(33,34)35-16-15-30(5)6/h17-19,23-24,31H,2,7-16H2,1,3-6H3,(H,33,34)/t23-,24+/m0/s1 |
| InChIKey | YHAABRURVBAUMU-BJKOFHAPSA-N |
| XLogP | 6.27 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|