C34H53O7P — CID 177092494
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[heptoxy(hydroxy)phosphoryl]oxycyclopentane-1-carboxylate (PubChem CID 177092494) has the molecular formula C34H53O7P and a molecular weight of 604.77 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[heptoxy(hydroxy)phosphoryl]oxycyclopentane-1-carboxylate.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[heptoxy(hydroxy)phosphoryl]oxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 177092494 |
| Molecular Formula | C34H53O7P |
| Molecular Weight | 604.77 g/mol |
| Exact Mass | 604.35 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[heptoxy(hydroxy)phosphoryl]oxycyclopentane-1-carboxylate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)C1(OP(=O)(O)OCCCCCCC)CCCC1 |
| InChI | InChI=1S/C34H53O7P/c1-6-8-10-11-15-21-39-42(37,38)41-34(19-13-14-20-34)33(36)40-31-24-27(16-12-9-7-2)23-30(35)32(31)29-22-26(5)17-18-28(29)25(3)4/h22-24,28-29,35H,3,6-21H2,1-2,4-5H3,(H,37,38)/t28-,29+/m0/s1 |
| InChIKey | DFMVPHRTWRDJLB-URLMMPGGSA-N |
| XLogP | 9.46 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.77 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|