C30H36O3 — CID 164786273
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-ethenylbenzoate (PubChem CID 164786273) has the molecular formula C30H36O3 and a molecular weight of 444.62 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-ethenylbenzoate.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-ethenylbenzoate |
|---|---|
| PubChem CID | 164786273 |
| Molecular Formula | C30H36O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)Oc2cc(CCCCC)cc(O)c2[C@@H]2C=C(C)CC[C@H]2C(=C)C)cc1 |
| InChI | InChI=1S/C30H36O3/c1-6-8-9-10-23-18-27(31)29(26-17-21(5)11-16-25(26)20(3)4)28(19-23)33-30(32)24-14-12-22(7-2)13-15-24/h7,12-15,17-19,25-26,31H,2-3,6,8-11,16H2,1,4-5H3/t25-,26+/m0/s1 |
| InChIKey | QUJRPADMWNAFGR-IZZNHLLZSA-N |
| XLogP | 8.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|