C31H38O4 — CID 177114646
[3-methoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-acetylbenzoate (PubChem CID 177114646) has the molecular formula C31H38O4 and a molecular weight of 474.64 g/mol. Its IUPAC name is [3-methoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-acetylbenzoate.
| Compound Name | [3-methoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-acetylbenzoate |
|---|---|
| PubChem CID | 177114646 |
| Molecular Formula | C31H38O4 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | [3-methoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-acetylbenzoate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(OC)cc(CCCCC)cc1OC(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C31H38O4/c1-7-8-9-10-23-18-28(34-6)30(27-17-21(4)11-16-26(27)20(2)3)29(19-23)35-31(33)25-14-12-24(13-15-25)22(5)32/h12-15,17-19,26-27H,2,7-11,16H2,1,3-6H3/t26-,27+/m0/s1 |
| InChIKey | LCWJCAOKKKUTSP-RRPNLBNLSA-N |
| XLogP | 7.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|