C33H48N2O3S3 — CID 164935520
[3-[2-(1-methylaziridin-2-yl)ethylsulfanylcarbothioyloxy]-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-(1-methylaziridin-2-yl)ethylsulfanylformate (PubChem CID 164935520) has the molecular formula C33H48N2O3S3 and a molecular weight of 616.96 g/mol. Its IUPAC name is [3-[2-(1-methylaziridin-2-yl)ethylsulfanylcarbothioyloxy]-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-(1-methylaziridin-2-yl)ethylsulfanylformate.
| Compound Name | [3-[2-(1-methylaziridin-2-yl)ethylsulfanylcarbothioyloxy]-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-(1-methylaziridin-2-yl)ethylsulfanylformate |
|---|---|
| PubChem CID | 164935520 |
| Molecular Formula | C33H48N2O3S3 |
| Molecular Weight | 616.96 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | [3-[2-(1-methylaziridin-2-yl)ethylsulfanylcarbothioyloxy]-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-(1-methylaziridin-2-yl)ethylsulfanylformate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(OC(=O)SCCC2CN2C)cc(CCCCC)cc1OC(=S)SCCC1CN1C |
| InChI | InChI=1S/C33H48N2O3S3/c1-7-8-9-10-24-18-29(37-32(36)40-15-13-25-20-34(25)5)31(28-17-23(4)11-12-27(28)22(2)3)30(19-24)38-33(39)41-16-14-26-21-35(26)6/h17-19,25-28H,2,7-16,20-21H2,1,3-6H3/t25?,26?,27-,28+,34?,35?/m0/s1 |
| InChIKey | ADTOWTSANXEBTA-MSSCBDPCSA-N |
| XLogP | 8.47 |
| TPSA | 41.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.96 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|