C27H39BO5 — CID 156733804
[3-tert-butyl-6,6-dimethyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] acetate (PubChem CID 156733804) has the molecular formula C27H39BO5 and a molecular weight of 454.42 g/mol. Its IUPAC name is [3-tert-butyl-6,6-dimethyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] acetate.
| Compound Name | [3-tert-butyl-6,6-dimethyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] acetate |
|---|---|
| PubChem CID | 156733804 |
| Molecular Formula | C27H39BO5 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | [3-tert-butyl-6,6-dimethyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] acetate |
| SMILES | CC(=O)Oc1cc(C(C)(C)C)cc2c1C1CC(B3OC(C)(C)C(C)(C)O3)=CCC1C(C)(C)O2 |
| InChI | InChI=1S/C27H39BO5/c1-16(29)30-21-13-17(24(2,3)4)14-22-23(21)19-15-18(11-12-20(19)25(5,6)31-22)28-32-26(7,8)27(9,10)33-28/h11,13-14,19-20H,12,15H2,1-10H3 |
| InChIKey | XMPIWYCAGJFCJL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|