C23H31NO2 — CID 153371300
(6aR,10aR)-1-methoxy-6,6-dimethyl-3-(2-methylpentan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carbonitrile (PubChem CID 153371300) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (6aR,10aR)-1-methoxy-6,6-dimethyl-3-(2-methylpentan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carbonitrile.
| Compound Name | (6aR,10aR)-1-methoxy-6,6-dimethyl-3-(2-methylpentan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carbonitrile |
|---|---|
| PubChem CID | 153371300 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (6aR,10aR)-1-methoxy-6,6-dimethyl-3-(2-methylpentan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carbonitrile |
| SMILES | CCCC(C)(C)c1cc(OC)c2c(c1)OC(C)(C)[C@@H]1CC=C(C#N)C[C@@H]21 |
| InChI | InChI=1S/C23H31NO2/c1-7-10-22(2,3)16-12-19(25-6)21-17-11-15(14-24)8-9-18(17)23(4,5)26-20(21)13-16/h8,12-13,17-18H,7,9-11H2,1-6H3/t17-,18-/m1/s1 |
| InChIKey | AEADAWWQGWGZQP-QZTJIDSGSA-N |
| XLogP | 5.89 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |