C26H36F3O3P — CID 156750500
6,6-dimethyl-1-methylphosphanyloxy-3-(8,8,8-trifluoro-2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carbaldehyde (PubChem CID 156750500) has the molecular formula C26H36F3O3P and a molecular weight of 484.54 g/mol. Its IUPAC name is 6,6-dimethyl-1-methylphosphanyloxy-3-(8,8,8-trifluoro-2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carbaldehyde.
| Compound Name | 6,6-dimethyl-1-methylphosphanyloxy-3-(8,8,8-trifluoro-2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carbaldehyde |
|---|---|
| PubChem CID | 156750500 |
| Molecular Formula | C26H36F3O3P |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 6,6-dimethyl-1-methylphosphanyloxy-3-(8,8,8-trifluoro-2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carbaldehyde |
| SMILES | CPOc1cc(C(C)(C)CCCCCC(F)(F)F)cc2c1C1CC(C=O)=CCC1C(C)(C)O2 |
| InChI | InChI=1S/C26H36F3O3P/c1-24(2,11-7-6-8-12-26(27,28)29)18-14-21-23(22(15-18)32-33-5)19-13-17(16-30)9-10-20(19)25(3,4)31-21/h9,14-16,19-20,33H,6-8,10-13H2,1-5H3 |
| InChIKey | JETXKYQGVCYULC-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|